About (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine
(2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine (PubChem CID 170074560) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine.
Molecular Properties
| Compound Name | (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine |
| PubChem CID | 170074560 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine |
| SMILES | CNC1CC=CC[C@H]1NC |
| InChI | InChI=1S/C8H16N2/c1-9-7-5-3-4-6-8(7)10-2/h3-4,7-10H,5-6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | QXXUPUHOJFIHGW-GVHYBUMESA-N |
| XLogP | 0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine?
The IUPAC name of (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine (CID 170074560) is (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine.
What is the SMILES notation for (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine?
The canonical SMILES for (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine is CNC1CC=CC[C@H]1NC.
What is the InChIKey of (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine?
The InChIKey is QXXUPUHOJFIHGW-GVHYBUMESA-N. The full InChI is InChI=1S/C8H16N2/c1-9-7-5-3-4-6-8(7)10-2/h3-4,7-10H,5-6H2,1-2H3/t7-,8?/m1/s1.
What are the key properties of (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine?
(2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine has a molecular weight of 140.23 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-N,2-N-dimethylcyclohex-4-ene-1,2-diamine is sourced from PubChem (CID 170074560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).