C53H60O6P2 — CID 170074711
[2-(2-benzo[d][1,3,2]benzodioxaphosphepin-6-yloxy-3,5-ditert-butylphenyl)-4,6-ditert-butylphenyl] [(2Z,4Z)-hepta-2,4-dien-6-ynyl] phenyl phosphite (PubChem CID 170074711) has the molecular formula C53H60O6P2 and a molecular weight of 855.01 g/mol. Its IUPAC name is [2-(2-benzo[d][1,3,2]benzodioxaphosphepin-6-yloxy-3,5-ditert-butylphenyl)-4,6-ditert-butylphenyl] [(2Z,4Z)-hepta-2,4-dien-6-ynyl] phenyl phosphite.
| Compound Name | [2-(2-benzo[d][1,3,2]benzodioxaphosphepin-6-yloxy-3,5-ditert-butylphenyl)-4,6-ditert-butylphenyl] [(2Z,4Z)-hepta-2,4-dien-6-ynyl] phenyl phosphite |
|---|---|
| PubChem CID | 170074711 |
| Molecular Formula | C53H60O6P2 |
| Molecular Weight | 855.01 g/mol |
| Exact Mass | 854.39 |
| IUPAC Name | [2-(2-benzo[d][1,3,2]benzodioxaphosphepin-6-yloxy-3,5-ditert-butylphenyl)-4,6-ditert-butylphenyl] [(2Z,4Z)-hepta-2,4-dien-6-ynyl] phenyl phosphite |
| SMILES | C#C/C=C\C=C/COP(Oc1ccccc1)Oc1c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2Op2oc3ccccc3c3ccccc3o2)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C53H60O6P2/c1-14-15-16-17-25-32-54-60(55-39-26-19-18-20-27-39)58-48-42(33-37(50(2,3)4)35-44(48)52(8,9)10)43-34-38(51(5,6)7)36-45(53(11,12)13)49(43)59-61-56-46-30-23-21-28-40(46)41-29-22-24-31-47(41)57-61/h1,15-31,33-36H,32H2,2-13H3/b16-15-,25-17- |
| InChIKey | ZKLKPGDDNYWJHP-PFBNVUBMSA-N |
| XLogP | 16.44 |
| TPSA | 63.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.01 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|