About 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol
1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol (PubChem CID 170074800) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol.
Molecular Properties
| Compound Name | 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol |
| PubChem CID | 170074800 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol |
| SMILES | C=CC1=CC=C(C(=C)O)C1 |
| InChI | InChI=1S/C9H10O/c1-3-8-4-5-9(6-8)7(2)10/h3-5,10H,1-2,6H2 |
| InChIKey | LXOJNEAXUSQKSH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol?
The IUPAC name of 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol (CID 170074800) is 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol.
What is the SMILES notation for 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol?
The canonical SMILES for 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol is C=CC1=CC=C(C(=C)O)C1.
What is the InChIKey of 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol?
The InChIKey is LXOJNEAXUSQKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-3-8-4-5-9(6-8)7(2)10/h3-5,10H,1-2,6H2.
What are the key properties of 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol?
1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol has a molecular weight of 134.18 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethenylcyclopenta-1,3-dien-1-yl)ethenol is sourced from PubChem (CID 170074800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).