About 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine
2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine (PubChem CID 170076014) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine.
Molecular Properties
| Compound Name | 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine |
| PubChem CID | 170076014 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine |
| SMILES | CC[C@@H](C)/C=C\N=C\C(C)F |
| InChI | InChI=1S/C9H16FN/c1-4-8(2)5-6-11-7-9(3)10/h5-9H,4H2,1-3H3/b6-5-,11-7+/t8-,9?/m1/s1 |
| InChIKey | AOUWDAOWTNIHGZ-HTCMKBSLSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine?
The IUPAC name of 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine (CID 170076014) is 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine.
What is the SMILES notation for 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine?
The canonical SMILES for 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine is CC[C@@H](C)/C=C\N=C\C(C)F.
What is the InChIKey of 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine?
The InChIKey is AOUWDAOWTNIHGZ-HTCMKBSLSA-N. The full InChI is InChI=1S/C9H16FN/c1-4-8(2)5-6-11-7-9(3)10/h5-9H,4H2,1-3H3/b6-5-,11-7+/t8-,9?/m1/s1.
What are the key properties of 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine?
2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine has a molecular weight of 157.23 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(Z,3R)-3-methylpent-1-enyl]propan-1-imine is sourced from PubChem (CID 170076014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).