C21H15F2N3O3S — CID 170076399
N-[1-[[7-[(2,4-difluorophenyl)methoxy]-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]formamide (PubChem CID 170076399) has the molecular formula C21H15F2N3O3S and a molecular weight of 427.43 g/mol. Its IUPAC name is N-[1-[[7-[(2,4-difluorophenyl)methoxy]-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]formamide.
| Compound Name | N-[1-[[7-[(2,4-difluorophenyl)methoxy]-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 170076399 |
| Molecular Formula | C21H15F2N3O3S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[1-[[7-[(2,4-difluorophenyl)methoxy]-1,3-benzothiazol-2-yl]methyl]-2-oxo-3-pyridinyl]formamide |
| SMILES | O=CNc1cccn(Cc2nc3cccc(OCc4ccc(F)cc4F)c3s2)c1=O |
| InChI | InChI=1S/C21H15F2N3O3S/c22-14-7-6-13(15(23)9-14)11-29-18-5-1-3-16-20(18)30-19(25-16)10-26-8-2-4-17(21(26)28)24-12-27/h1-9,12H,10-11H2,(H,24,27) |
| InChIKey | PVTAXSVABCLPIB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|