C23H19FN4O7S — CID 170076882
[(19S)-19-ethyl-6-fluoro-14,18-dioxo-19-(sulfanylcarbamoyloxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-methylcarbamate (PubChem CID 170076882) has the molecular formula C23H19FN4O7S and a molecular weight of 514.49 g/mol. Its IUPAC name is [(19S)-19-ethyl-6-fluoro-14,18-dioxo-19-(sulfanylcarbamoyloxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-methylcarbamate.
| Compound Name | [(19S)-19-ethyl-6-fluoro-14,18-dioxo-19-(sulfanylcarbamoyloxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 170076882 |
| Molecular Formula | C23H19FN4O7S |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [(19S)-19-ethyl-6-fluoro-14,18-dioxo-19-(sulfanylcarbamoyloxy)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl] N-methylcarbamate |
| SMILES | CC[C@@]1(OC(=O)NS)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(OC(=O)NC)c(F)cc3nc2-1 |
| InChI | InChI=1S/C23H19FN4O7S/c1-3-23(35-22(32)27-36)13-6-16-18-11(8-28(16)19(29)12(13)9-33-20(23)30)4-10-5-17(34-21(31)25-2)14(24)7-15(10)26-18/h4-7,36H,3,8-9H2,1-2H3,(H,25,31)(H,27,32)/t23-/m0/s1 |
| InChIKey | VIKXZIYMFYWKLH-QHCPKHFHSA-N |
| XLogP | 2.52 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|