C32H37NOP+ — CID 170077048
6-[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]hexyl-triphenylphosphanium (PubChem CID 170077048) has the molecular formula C32H37NOP+ and a molecular weight of 482.63 g/mol. Its IUPAC name is 6-[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]hexyl-triphenylphosphanium.
| Compound Name | 6-[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]hexyl-triphenylphosphanium |
|---|---|
| PubChem CID | 170077048 |
| Molecular Formula | C32H37NOP+ |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 6-[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]hexyl-triphenylphosphanium |
| SMILES | C=C/C(=C\C=C/C)C(=O)NCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H36NOP/c1-3-5-19-28(4-2)32(34)33-26-17-6-7-18-27-35(29-20-11-8-12-21-29,30-22-13-9-14-23-30)31-24-15-10-16-25-31/h3-5,8-16,19-25H,2,6-7,17-18,26-27H2,1H3/p+1/b5-3-,28-19+ |
| InChIKey | WIRDINDXXAVFRU-NXPBVSJYSA-O |
| XLogP | 6.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|