About 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol
2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol (PubChem CID 170077786) has the molecular formula C11H15FOS
and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol |
| PubChem CID | 170077786 |
| Molecular Formula | C11H15FOS |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol |
| SMILES | CCSCC(O)C1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C11H15FOS/c1-2-14-8-11(13)9-4-3-5-10(12)7-6-9/h4-7,11,13H,2-3,8H2,1H3 |
| InChIKey | BBFHTHSHOURNDX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol?
The IUPAC name of 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol (CID 170077786) is 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol.
What is the SMILES notation for 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol?
The canonical SMILES for 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol is CCSCC(O)C1=CCC=C(F)C=C1.
What is the InChIKey of 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol?
The InChIKey is BBFHTHSHOURNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FOS/c1-2-14-8-11(13)9-4-3-5-10(12)7-6-9/h4-7,11,13H,2-3,8H2,1H3.
What are the key properties of 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol?
2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol has a molecular weight of 214.30 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-1-(5-fluorocyclohepta-1,4,6-trien-1-yl)ethanol is sourced from PubChem (CID 170077786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).