About 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine
1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine (PubChem CID 170078336) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine |
| PubChem CID | 170078336 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine |
| SMILES | C=C/C=C(\C)CNNCCF |
| InChI | InChI=1S/C8H15FN2/c1-3-4-8(2)7-11-10-6-5-9/h3-4,10-11H,1,5-7H2,2H3/b8-4+ |
| InChIKey | VTNSXCRBJZVDAD-XBXARRHUSA-N |
| XLogP | 1.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine?
The IUPAC name of 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine (CID 170078336) is 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine.
What is the SMILES notation for 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine?
The canonical SMILES for 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine is C=C/C=C(\C)CNNCCF.
What is the InChIKey of 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine?
The InChIKey is VTNSXCRBJZVDAD-XBXARRHUSA-N. The full InChI is InChI=1S/C8H15FN2/c1-3-4-8(2)7-11-10-6-5-9/h3-4,10-11H,1,5-7H2,2H3/b8-4+.
What are the key properties of 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine?
1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine has a molecular weight of 158.22 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-2-[(2E)-2-methylpenta-2,4-dienyl]hydrazine is sourced from PubChem (CID 170078336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).