C48H33N3O2 — CID 170078348
2-(7H-cyclohepta[b][1]benzofuran-9-yl)-4-[2-(4-cyclohepta-1,3,5-trien-1-ylphenyl)cyclohepta-1,3,6-trien-1-yl]-6-dibenzofuran-4-yl-1,3,5-triazine (PubChem CID 170078348) has the molecular formula C48H33N3O2 and a molecular weight of 683.81 g/mol. Its IUPAC name is 2-(7H-cyclohepta[b][1]benzofuran-9-yl)-4-[2-(4-cyclohepta-1,3,5-trien-1-ylphenyl)cyclohepta-1,3,6-trien-1-yl]-6-dibenzofuran-4-yl-1,3,5-triazine.
| Compound Name | 2-(7H-cyclohepta[b][1]benzofuran-9-yl)-4-[2-(4-cyclohepta-1,3,5-trien-1-ylphenyl)cyclohepta-1,3,6-trien-1-yl]-6-dibenzofuran-4-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 170078348 |
| Molecular Formula | C48H33N3O2 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 2-(7H-cyclohepta[b][1]benzofuran-9-yl)-4-[2-(4-cyclohepta-1,3,5-trien-1-ylphenyl)cyclohepta-1,3,6-trien-1-yl]-6-dibenzofuran-4-yl-1,3,5-triazine |
| SMILES | C1=CC=C(c2ccc(C3=C(c4nc(C5=CCC=c6oc7ccccc7c6=C5)nc(-c5cccc6c5oc5ccccc56)n4)C=CCC=C3)cc2)CC=C1 |
| InChI | InChI=1S/C48H33N3O2/c1-2-5-15-31(14-4-1)32-26-28-33(29-27-32)35-17-6-3-7-20-39(35)47-49-46(34-16-12-25-44-41(30-34)37-19-9-10-23-42(37)52-44)50-48(51-47)40-22-13-21-38-36-18-8-11-24-43(36)53-45(38)40/h1-2,4-11,13-14,16-30H,3,12,15H2 |
| InChIKey | UXTRKIRBBAZYBO-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |