C26H40F5NO4 — CID 170078534
[4-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate (PubChem CID 170078534) has the molecular formula C26H40F5NO4 and a molecular weight of 525.60 g/mol. Its IUPAC name is [4-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate.
| Compound Name | [4-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 170078534 |
| Molecular Formula | C26H40F5NO4 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | [4-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)-5-(2,4,4-trimethylhexan-2-yloxy)pentan-2-yl] 4-aminobenzoate |
| SMILES | CCC(C)(C)CC(C)(C)OCC(C)(COCC(F)(F)C(F)(F)F)CC(C)OC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H40F5NO4/c1-8-22(3,4)14-23(5,6)35-16-24(7,15-34-17-25(27,28)26(29,30)31)13-18(2)36-21(33)19-9-11-20(32)12-10-19/h9-12,18H,8,13-17,32H2,1-7H3 |
| InChIKey | AIZZJSYIIFIBKN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|