About 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine
2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine (PubChem CID 170079985) has the molecular formula C7H7N5S
and a molecular weight of 193.24 g/mol. Its IUPAC name is 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine |
| PubChem CID | 170079985 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine |
| SMILES | CSc1nccnc1-n1cncn1 |
| InChI | InChI=1S/C7H7N5S/c1-13-7-6(9-2-3-10-7)12-5-8-4-11-12/h2-5H,1H3 |
| InChIKey | ZPAUJBWRPCJGNX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine?
The IUPAC name of 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine (CID 170079985) is 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine.
What is the SMILES notation for 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine?
The canonical SMILES for 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine is CSc1nccnc1-n1cncn1.
What is the InChIKey of 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine?
The InChIKey is ZPAUJBWRPCJGNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5S/c1-13-7-6(9-2-3-10-7)12-5-8-4-11-12/h2-5H,1H3.
What are the key properties of 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine?
2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine has a molecular weight of 193.24 g/mol, XLogP of 0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3-(1,2,4-triazol-1-yl)pyrazine is sourced from PubChem (CID 170079985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).