About N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide
N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide (PubChem CID 170080558) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide |
| PubChem CID | 170080558 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide |
| SMILES | CCC(C)(C)[C@H](C)N(C(=O)C(C)C)C1CC1 |
| InChI | InChI=1S/C14H27NO/c1-7-14(5,6)11(4)15(12-8-9-12)13(16)10(2)3/h10-12H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | CYGKGGWLRNBBGW-NSHDSACASA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide?
The IUPAC name of N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide (CID 170080558) is N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide.
What is the SMILES notation for N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide?
The canonical SMILES for N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide is CCC(C)(C)[C@H](C)N(C(=O)C(C)C)C1CC1.
What is the InChIKey of N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide?
The InChIKey is CYGKGGWLRNBBGW-NSHDSACASA-N. The full InChI is InChI=1S/C14H27NO/c1-7-14(5,6)11(4)15(12-8-9-12)13(16)10(2)3/h10-12H,7-9H2,1-6H3/t11-/m0/s1.
What are the key properties of N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide?
N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide has a molecular weight of 225.38 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-[(2S)-3,3-dimethylpentan-2-yl]-2-methylpropanamide is sourced from PubChem (CID 170080558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).