About 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one
5-dimethylphosphoryl-1,6-dimethylquinolin-2-one (PubChem CID 170080915) has the molecular formula C13H16NO2P
and a molecular weight of 249.25 g/mol. Its IUPAC name is 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one |
| PubChem CID | 170080915 |
| Molecular Formula | C13H16NO2P |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(ccc(=O)n2C)c1P(C)(C)=O |
| InChI | InChI=1S/C13H16NO2P/c1-9-5-7-11-10(13(9)17(3,4)16)6-8-12(15)14(11)2/h5-8H,1-4H3 |
| InChIKey | GDQFUSLVBPUEFU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one?
The IUPAC name of 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one (CID 170080915) is 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one.
What is the SMILES notation for 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one?
The canonical SMILES for 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one is Cc1ccc2c(ccc(=O)n2C)c1P(C)(C)=O.
What is the InChIKey of 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one?
The InChIKey is GDQFUSLVBPUEFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16NO2P/c1-9-5-7-11-10(13(9)17(3,4)16)6-8-12(15)14(11)2/h5-8H,1-4H3.
What are the key properties of 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one?
5-dimethylphosphoryl-1,6-dimethylquinolin-2-one has a molecular weight of 249.25 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-dimethylphosphoryl-1,6-dimethylquinolin-2-one is sourced from PubChem (CID 170080915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).