About (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine
(Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine (PubChem CID 170081505) has the molecular formula C4H9ClN2
and a molecular weight of 120.58 g/mol. Its IUPAC name is (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine |
| PubChem CID | 170081505 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine |
| SMILES | CN/C=C\N(C)Cl |
| InChI | InChI=1S/C4H9ClN2/c1-6-3-4-7(2)5/h3-4,6H,1-2H3/b4-3- |
| InChIKey | SMSITODAXDJVJO-ARJAWSKDSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine?
The IUPAC name of (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine (CID 170081505) is (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine.
What is the SMILES notation for (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine?
The canonical SMILES for (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine is CN/C=C\N(C)Cl.
What is the InChIKey of (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine?
The InChIKey is SMSITODAXDJVJO-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H9ClN2/c1-6-3-4-7(2)5/h3-4,6H,1-2H3/b4-3-.
What are the key properties of (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine?
(Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine has a molecular weight of 120.58 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine is sourced from PubChem (CID 170081505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).