C4H9ClN2 — CID 170081505
(Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine (PubChem CID 170081505) has the molecular formula C4H9ClN2 and a molecular weight of 120.58 g/mol. Its IUPAC name is (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 170081505 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (Z)-N'-chloro-N,N'-dimethylethene-1,2-diamine |
| SMILES | CN/C=C\N(C)Cl |
| InChI | InChI=1S/C4H9ClN2/c1-6-3-4-7(2)5/h3-4,6H,1-2H3/b4-3- |
| InChIKey | SMSITODAXDJVJO-ARJAWSKDSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|