C16H20F2 — CID 170081606
1,2-difluoro-4-[(1Z,3E)-2,4,5,5-tetramethylhexa-1,3-dienyl]benzene (PubChem CID 170081606) has the molecular formula C16H20F2 and a molecular weight of 250.33 g/mol. Its IUPAC name is 1,2-difluoro-4-[(1Z,3E)-2,4,5,5-tetramethylhexa-1,3-dienyl]benzene.
| Compound Name | 1,2-difluoro-4-[(1Z,3E)-2,4,5,5-tetramethylhexa-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 170081606 |
| Molecular Formula | C16H20F2 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,2-difluoro-4-[(1Z,3E)-2,4,5,5-tetramethylhexa-1,3-dienyl]benzene |
| SMILES | CC(=C/c1ccc(F)c(F)c1)/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C16H20F2/c1-11(8-12(2)16(3,4)5)9-13-6-7-14(17)15(18)10-13/h6-10H,1-5H3/b11-9-,12-8+ |
| InChIKey | FLCVRQYDKPWDBF-NFDHXRNHSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|