C19H10F6O5 — CID 170081650
4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoic acid (PubChem CID 170081650) has the molecular formula C19H10F6O5 and a molecular weight of 432.27 g/mol. Its IUPAC name is 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoic acid.
| Compound Name | 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 170081650 |
| Molecular Formula | C19H10F6O5 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1cc(C(c2ccc3c(c2)C(=O)OC3=O)(C(F)(F)F)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C19H10F6O5/c1-8-6-9(2-4-11(8)14(26)27)17(18(20,21)22,19(23,24)25)10-3-5-12-13(7-10)16(29)30-15(12)28/h2-7H,1H3,(H,26,27) |
| InChIKey | QZKWLFVJOVFVCY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|