C13H20FN — CID 170081889
(3Z,5E)-N-[(E)-2,3-dimethylbut-1-enyl]-5-fluorohepta-3,5-dien-2-imine (PubChem CID 170081889) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (3Z,5E)-N-[(E)-2,3-dimethylbut-1-enyl]-5-fluorohepta-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-N-[(E)-2,3-dimethylbut-1-enyl]-5-fluorohepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 170081889 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (3Z,5E)-N-[(E)-2,3-dimethylbut-1-enyl]-5-fluorohepta-3,5-dien-2-imine |
| SMILES | C/C=C(F)\C=C/C(C)=N/C=C(\C)C(C)C |
| InChI | InChI=1S/C13H20FN/c1-6-13(14)8-7-12(5)15-9-11(4)10(2)3/h6-10H,1-5H3/b8-7-,11-9+,13-6+,15-12+ |
| InChIKey | LAPQHLVOSCZJIS-VNFNVARVSA-N |
| XLogP | 4.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|