C26H32N5O2S+ — CID 170081890
N-[4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[(4-methoxy-2,2-dimethylthiomorpholin-4-ium-4-yl)methyl]benzamide (PubChem CID 170081890) has the molecular formula C26H32N5O2S+ and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[(4-methoxy-2,2-dimethylthiomorpholin-4-ium-4-yl)methyl]benzamide.
| Compound Name | N-[4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[(4-methoxy-2,2-dimethylthiomorpholin-4-ium-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 170081890 |
| Molecular Formula | C26H32N5O2S+ |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[4-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)phenyl]-3-[(4-methoxy-2,2-dimethylthiomorpholin-4-ium-4-yl)methyl]benzamide |
| SMILES | CO[N+]1(Cc2cccc(C(=O)Nc3ccc(-c4n[nH]c(C5CC5)n4)cc3)c2)CCSC(C)(C)C1 |
| InChI | InChI=1S/C26H31N5O2S/c1-26(2)17-31(33-3,13-14-34-26)16-18-5-4-6-21(15-18)25(32)27-22-11-9-20(10-12-22)24-28-23(29-30-24)19-7-8-19/h4-6,9-12,15,19H,7-8,13-14,16-17H2,1-3H3,(H-,27,28,29,30,32)/p+1 |
| InChIKey | NOXONMLQCSLUGV-UHFFFAOYSA-O |
| XLogP | 5.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|