About 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane
7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane (PubChem CID 170081976) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane.
Molecular Properties
| Compound Name | 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane |
| PubChem CID | 170081976 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane |
| SMILES | CCN1CC(C)CC2CC3C2CCC31 |
| InChI | InChI=1S/C13H23N/c1-3-14-8-9(2)6-10-7-12-11(10)4-5-13(12)14/h9-13H,3-8H2,1-2H3 |
| InChIKey | AJSFRRMFXDWHQI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane?
The IUPAC name of 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane (CID 170081976) is 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane.
What is the SMILES notation for 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane?
The canonical SMILES for 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane is CCN1CC(C)CC2CC3C2CCC31.
What is the InChIKey of 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane?
The InChIKey is AJSFRRMFXDWHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-3-14-8-9(2)6-10-7-12-11(10)4-5-13(12)14/h9-13H,3-8H2,1-2H3.
What are the key properties of 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane?
7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane has a molecular weight of 193.33 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5-methyl-7-azatricyclo[6.3.0.03,11]undecane is sourced from PubChem (CID 170081976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).