C20H27N5O4 — CID 170082112
[(1R,3S)-3-[3-[[2-(3-methyl-1,2-oxazol-5-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] (2S,3S)-2,3-dimethylazetidine-1-carboxylate (PubChem CID 170082112) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is [(1R,3S)-3-[3-[[2-(3-methyl-1,2-oxazol-5-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] (2S,3S)-2,3-dimethylazetidine-1-carboxylate.
| Compound Name | [(1R,3S)-3-[3-[[2-(3-methyl-1,2-oxazol-5-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] (2S,3S)-2,3-dimethylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 170082112 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | [(1R,3S)-3-[3-[[2-(3-methyl-1,2-oxazol-5-yl)acetyl]amino]-1H-pyrazol-5-yl]cyclopentyl] (2S,3S)-2,3-dimethylazetidine-1-carboxylate |
| SMILES | Cc1cc(CC(=O)Nc2cc([C@H]3CC[C@@H](OC(=O)N4C[C@H](C)[C@@H]4C)C3)[nH]n2)on1 |
| InChI | InChI=1S/C20H27N5O4/c1-11-10-25(13(11)3)20(27)28-15-5-4-14(7-15)17-9-18(23-22-17)21-19(26)8-16-6-12(2)24-29-16/h6,9,11,13-15H,4-5,7-8,10H2,1-3H3,(H2,21,22,23,26)/t11-,13-,14-,15+/m0/s1 |
| InChIKey | MDQHCVUGUSOUPN-CYUUQNCZSA-N |
| XLogP | 3.00 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |