C18H14F3N3O2 — CID 170082549
5-(2-methyl-1-benzofuran-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)pyridine-2-carbaldehyde (PubChem CID 170082549) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 5-(2-methyl-1-benzofuran-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)pyridine-2-carbaldehyde.
| Compound Name | 5-(2-methyl-1-benzofuran-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 170082549 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 5-(2-methyl-1-benzofuran-3-carboximidoyl)-4-(2,2,2-trifluoroethylamino)pyridine-2-carbaldehyde |
| SMILES | [H]/N=C(/c1cnc(C=O)cc1NCC(F)(F)F)c1c(C)oc2ccccc12 |
| InChI | InChI=1S/C18H14F3N3O2/c1-10-16(12-4-2-3-5-15(12)26-10)17(22)13-7-23-11(8-25)6-14(13)24-9-18(19,20)21/h2-8,22H,9H2,1H3,(H,23,24)/b22-17- |
| InChIKey | DDIIPNQPCHJQAG-XLNRJJMWSA-N |
| XLogP | 4.34 |
| TPSA | 78.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|