C23H35N3O3S — CID 170082635
(1R,2S)-3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylphenyl)sulfinylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170082635) has the molecular formula C23H35N3O3S and a molecular weight of 433.62 g/mol. Its IUPAC name is (1R,2S)-3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylphenyl)sulfinylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S)-3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylphenyl)sulfinylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170082635 |
| Molecular Formula | C23H35N3O3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | (1R,2S)-3-[(2S)-3,3-dimethyl-2-[(2,4,6-trimethylphenyl)sulfinylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)N[C@H](C(=O)N2CC3[C@@H]([C@H]2C(N)=O)C3(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C23H35N3O3S/c1-12-9-13(2)18(14(3)10-12)30(29)25-19(22(4,5)6)21(28)26-11-15-16(23(15,7)8)17(26)20(24)27/h9-10,15-17,19,25H,11H2,1-8H3,(H2,24,27)/t15?,16-,17-,19+,30?/m0/s1 |
| InChIKey | UMTNGBLNJADDMG-QDSWGBNXSA-N |
| XLogP | 2.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |