C24H21ClN5O3S- — CID 170082885
2-[[3-[[4-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinate (PubChem CID 170082885) has the molecular formula C24H21ClN5O3S- and a molecular weight of 494.98 g/mol. Its IUPAC name is 2-[[3-[[4-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinate.
| Compound Name | 2-[[3-[[4-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinate |
|---|---|
| PubChem CID | 170082885 |
| Molecular Formula | C24H21ClN5O3S- |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[[3-[[4-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]phenyl]carbamoyl]phenyl]methylamino]ethanesulfinate |
| SMILES | O=C(Nc1ccc(-c2nc(-c3cccc(Cl)c3)n[nH]2)cc1)c1cccc(CNCCS(=O)[O-])c1 |
| InChI | InChI=1S/C24H22ClN5O3S/c25-20-6-2-4-18(14-20)23-28-22(29-30-23)17-7-9-21(10-8-17)27-24(31)19-5-1-3-16(13-19)15-26-11-12-34(32)33/h1-10,13-14,26H,11-12,15H2,(H,27,31)(H,32,33)(H,28,29,30)/p-1 |
| InChIKey | CSHNBSVYSMTWLN-UHFFFAOYSA-M |
| XLogP | 4.01 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|