C19H28N4O2 — CID 170083339
6-[(1Z)-buta-1,3-dienyl]-2-(ethoxymethyl)-7-(3-methylbutoxymethyl)-3H-imidazo[4,5-c]pyridin-4-amine (PubChem CID 170083339) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-2-(ethoxymethyl)-7-(3-methylbutoxymethyl)-3H-imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-2-(ethoxymethyl)-7-(3-methylbutoxymethyl)-3H-imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 170083339 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-2-(ethoxymethyl)-7-(3-methylbutoxymethyl)-3H-imidazo[4,5-c]pyridin-4-amine |
| SMILES | C=C/C=C\c1nc(N)c2[nH]c(COCC)nc2c1COCCC(C)C |
| InChI | InChI=1S/C19H28N4O2/c1-5-7-8-15-14(11-25-10-9-13(3)4)17-18(19(20)21-15)23-16(22-17)12-24-6-2/h5,7-8,13H,1,6,9-12H2,2-4H3,(H2,20,21)(H,22,23)/b8-7- |
| InChIKey | IPDVCIDRSDFTLZ-FPLPWBNLSA-N |
| XLogP | 3.84 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|