C16H22BrIN4O — CID 170083500
(2S,4R,5R)-N-(6-bromo-3-cyclopropyl-2-pyridinyl)-4-[(dimethylamino)methyl]-5-iodopyrrolidine-2-carboxamide (PubChem CID 170083500) has the molecular formula C16H22BrIN4O and a molecular weight of 493.19 g/mol. Its IUPAC name is (2S,4R,5R)-N-(6-bromo-3-cyclopropyl-2-pyridinyl)-4-[(dimethylamino)methyl]-5-iodopyrrolidine-2-carboxamide.
| Compound Name | (2S,4R,5R)-N-(6-bromo-3-cyclopropyl-2-pyridinyl)-4-[(dimethylamino)methyl]-5-iodopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170083500 |
| Molecular Formula | C16H22BrIN4O |
| Molecular Weight | 493.19 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | (2S,4R,5R)-N-(6-bromo-3-cyclopropyl-2-pyridinyl)-4-[(dimethylamino)methyl]-5-iodopyrrolidine-2-carboxamide |
| SMILES | CN(C)C[C@H]1C[C@@H](C(=O)Nc2nc(Br)ccc2C2CC2)N[C@@H]1I |
| InChI | InChI=1S/C16H22BrIN4O/c1-22(2)8-10-7-12(19-14(10)18)16(23)21-15-11(9-3-4-9)5-6-13(17)20-15/h5-6,9-10,12,14,19H,3-4,7-8H2,1-2H3,(H,20,21,23)/t10-,12+,14+/m1/s1 |
| InChIKey | FMBLEUNTMNNIDM-OSMZGAPFSA-N |
| XLogP | 2.96 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|