C29H43ClN2O6S — CID 170083808
6-[(2E,4E)-6-[4-chloro-3-methoxy-5-(methoxyamino)phenyl]-1-methoxy-5-methylhexa-2,4-dienyl]-6-hydroxy-4-[1-[3-methyl-3-(1-sulfanylpropyl)oxiran-2-yl]ethyl]piperidin-2-one (PubChem CID 170083808) has the molecular formula C29H43ClN2O6S and a molecular weight of 583.19 g/mol. Its IUPAC name is 6-[(2E,4E)-6-[4-chloro-3-methoxy-5-(methoxyamino)phenyl]-1-methoxy-5-methylhexa-2,4-dienyl]-6-hydroxy-4-[1-[3-methyl-3-(1-sulfanylpropyl)oxiran-2-yl]ethyl]piperidin-2-one.
| Compound Name | 6-[(2E,4E)-6-[4-chloro-3-methoxy-5-(methoxyamino)phenyl]-1-methoxy-5-methylhexa-2,4-dienyl]-6-hydroxy-4-[1-[3-methyl-3-(1-sulfanylpropyl)oxiran-2-yl]ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 170083808 |
| Molecular Formula | C29H43ClN2O6S |
| Molecular Weight | 583.19 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 6-[(2E,4E)-6-[4-chloro-3-methoxy-5-(methoxyamino)phenyl]-1-methoxy-5-methylhexa-2,4-dienyl]-6-hydroxy-4-[1-[3-methyl-3-(1-sulfanylpropyl)oxiran-2-yl]ethyl]piperidin-2-one |
| SMILES | CCC(S)C1(C)OC1C(C)C1CC(=O)NC(O)(C(/C=C/C=C(\C)Cc2cc(NOC)c(Cl)c(OC)c2)OC)C1 |
| InChI | InChI=1S/C29H43ClN2O6S/c1-8-24(39)28(4)27(38-28)18(3)20-15-25(33)31-29(34,16-20)23(36-6)11-9-10-17(2)12-19-13-21(32-37-7)26(30)22(14-19)35-5/h9-11,13-14,18,20,23-24,27,32,34,39H,8,12,15-16H2,1-7H3,(H,31,33)/b11-9+,17-10+ |
| InChIKey | VZVVDOOLXUKOIE-ATELFFGISA-N |
| XLogP | 5.10 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.19 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|