C13H11F3INO3 — CID 170083839
methyl 8-iodo-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-6-carboxylate (PubChem CID 170083839) has the molecular formula C13H11F3INO3 and a molecular weight of 413.13 g/mol. Its IUPAC name is methyl 8-iodo-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-6-carboxylate.
| Compound Name | methyl 8-iodo-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 170083839 |
| Molecular Formula | C13H11F3INO3 |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | methyl 8-iodo-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-6-carboxylate |
| SMILES | COC(=O)c1cc(I)c2c(c1)CCN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H11F3INO3/c1-21-11(19)8-4-7-2-3-18(12(20)13(14,15)16)6-9(7)10(17)5-8/h4-5H,2-3,6H2,1H3 |
| InChIKey | REPFMSZKQHGUDQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|