C14H13N5O — CID 170084068
11-oxospiro[5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-12,3'-cyclopentane]-1'-carbonitrile (PubChem CID 170084068) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 11-oxospiro[5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-12,3'-cyclopentane]-1'-carbonitrile.
| Compound Name | 11-oxospiro[5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-12,3'-cyclopentane]-1'-carbonitrile |
|---|---|
| PubChem CID | 170084068 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 11-oxospiro[5,7,10,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-12,3'-cyclopentane]-1'-carbonitrile |
| SMILES | N#CC1CCC2(C1)Nc1c(cnc3[nH]ccc13)NC2=O |
| InChI | InChI=1S/C14H13N5O/c15-6-8-1-3-14(5-8)13(20)18-10-7-17-12-9(2-4-16-12)11(10)19-14/h2,4,7-8,19H,1,3,5H2,(H,16,17)(H,18,20) |
| InChIKey | MKAOUAOMHSTESA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |