About 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide
6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide (PubChem CID 170084987) has the molecular formula C9H11F3N4
and a molecular weight of 232.21 g/mol. Its IUPAC name is 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide |
| PubChem CID | 170084987 |
| Molecular Formula | C9H11F3N4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc(C)cc1NCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N4/c1-5-2-7(16-4-9(10,11)12)6(3-15-5)8(13)14/h2-3H,4H2,1H3,(H3,13,14)(H,15,16) |
| InChIKey | VQYQUPMZDORPJU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide?
The IUPAC name of 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide (CID 170084987) is 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide.
What is the SMILES notation for 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide?
The canonical SMILES for 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide is [H]/N=C(\N)c1cnc(C)cc1NCC(F)(F)F.
What is the InChIKey of 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide?
The InChIKey is VQYQUPMZDORPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N4/c1-5-2-7(16-4-9(10,11)12)6(3-15-5)8(13)14/h2-3H,4H2,1H3,(H3,13,14)(H,15,16).
What are the key properties of 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide?
6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide has a molecular weight of 232.21 g/mol, XLogP of 1.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(2,2,2-trifluoroethylamino)pyridine-3-carboximidamide is sourced from PubChem (CID 170084987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).