C19H21N3 — CID 170085299
1,2-bis(4-ethenylcyclohepta-1,3,6-trien-1-yl)guanidine (PubChem CID 170085299) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1,2-bis(4-ethenylcyclohepta-1,3,6-trien-1-yl)guanidine.
| Compound Name | 1,2-bis(4-ethenylcyclohepta-1,3,6-trien-1-yl)guanidine |
|---|---|
| PubChem CID | 170085299 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1,2-bis(4-ethenylcyclohepta-1,3,6-trien-1-yl)guanidine |
| SMILES | C=CC1=CC=C(/N=C(\N)NC2=CC=C(C=C)CC=C2)C=CC1 |
| InChI | InChI=1S/C19H21N3/c1-3-15-7-5-9-17(13-11-15)21-19(20)22-18-10-6-8-16(4-2)12-14-18/h3-6,9-14H,1-2,7-8H2,(H3,20,21,22) |
| InChIKey | IHRLPXWJEQGRNV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|