C9H17NO7P2 — CID 170085376
N-bis(prop-2-enoxy)phosphoryl-1-dimethoxyphosphorylformamide (PubChem CID 170085376) has the molecular formula C9H17NO7P2 and a molecular weight of 313.18 g/mol. Its IUPAC name is N-bis(prop-2-enoxy)phosphoryl-1-dimethoxyphosphorylformamide.
| Compound Name | N-bis(prop-2-enoxy)phosphoryl-1-dimethoxyphosphorylformamide |
|---|---|
| PubChem CID | 170085376 |
| Molecular Formula | C9H17NO7P2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-bis(prop-2-enoxy)phosphoryl-1-dimethoxyphosphorylformamide |
| SMILES | C=CCOP(=O)(NC(=O)P(=O)(OC)OC)OCC=C |
| InChI | InChI=1S/C9H17NO7P2/c1-5-7-16-19(13,17-8-6-2)10-9(11)18(12,14-3)15-4/h5-6H,1-2,7-8H2,3-4H3,(H,10,11,13) |
| InChIKey | ZDYGRYZLKFAVQK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|