About 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline
8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 170085418) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 170085418 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCc1cc(C)cc2c1CN(C)CC2 |
| InChI | InChI=1S/C13H19N/c1-4-11-7-10(2)8-12-5-6-14(3)9-13(11)12/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | QUEJBESEEISRNB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline (CID 170085418) is 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline is CCc1cc(C)cc2c1CN(C)CC2.
What is the InChIKey of 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is QUEJBESEEISRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-4-11-7-10(2)8-12-5-6-14(3)9-13(11)12/h7-8H,4-6,9H2,1-3H3.
What are the key properties of 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline?
8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 189.30 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-2,6-dimethyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 170085418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).