About prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate
prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate (PubChem CID 170085564) has the molecular formula C5H6FNO4S
and a molecular weight of 195.17 g/mol. Its IUPAC name is prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate.
Molecular Properties
| Compound Name | prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate |
| PubChem CID | 170085564 |
| Molecular Formula | C5H6FNO4S |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate |
| SMILES | C#CCOC(=O)N(C)S(=O)(=O)F |
| InChI | InChI=1S/C5H6FNO4S/c1-3-4-11-5(8)7(2)12(6,9)10/h1H,4H2,2H3 |
| InChIKey | BDHFFAYQIHORNY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate?
The IUPAC name of prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate (CID 170085564) is prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate.
What is the SMILES notation for prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate?
The canonical SMILES for prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate is C#CCOC(=O)N(C)S(=O)(=O)F.
What is the InChIKey of prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate?
The InChIKey is BDHFFAYQIHORNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FNO4S/c1-3-4-11-5(8)7(2)12(6,9)10/h1H,4H2,2H3.
What are the key properties of prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate?
prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate has a molecular weight of 195.17 g/mol, XLogP of -0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl N-fluorosulfonyl-N-methylcarbamate is sourced from PubChem (CID 170085564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).