C17H34N2 — CID 170085633
(E)-1-N'-(4,4-dimethylpent-1-en-2-yl)-1-N,1-N,1-N',4,4-pentamethylpent-1-ene-1,1-diamine (PubChem CID 170085633) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is (E)-1-N'-(4,4-dimethylpent-1-en-2-yl)-1-N,1-N,1-N',4,4-pentamethylpent-1-ene-1,1-diamine.
| Compound Name | (E)-1-N'-(4,4-dimethylpent-1-en-2-yl)-1-N,1-N,1-N',4,4-pentamethylpent-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 170085633 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | (E)-1-N'-(4,4-dimethylpent-1-en-2-yl)-1-N,1-N,1-N',4,4-pentamethylpent-1-ene-1,1-diamine |
| SMILES | C=C(CC(C)(C)C)N(C)/C(=C/CC(C)(C)C)N(C)C |
| InChI | InChI=1S/C17H34N2/c1-14(13-17(5,6)7)19(10)15(18(8)9)11-12-16(2,3)4/h11H,1,12-13H2,2-10H3/b15-11+ |
| InChIKey | FWVUJEWHNQKLHH-RVDMUPIBSA-N |
| XLogP | 4.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |