C14H29NO — CID 170086248
4,4-dimethyl-2-(2,3,3-trimethylbutan-2-yloxy)pent-1-en-3-amine (PubChem CID 170086248) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,3,3-trimethylbutan-2-yloxy)pent-1-en-3-amine.
| Compound Name | 4,4-dimethyl-2-(2,3,3-trimethylbutan-2-yloxy)pent-1-en-3-amine |
|---|---|
| PubChem CID | 170086248 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 4,4-dimethyl-2-(2,3,3-trimethylbutan-2-yloxy)pent-1-en-3-amine |
| SMILES | C=C(OC(C)(C)C(C)(C)C)C(N)C(C)(C)C |
| InChI | InChI=1S/C14H29NO/c1-10(11(15)12(2,3)4)16-14(8,9)13(5,6)7/h11H,1,15H2,2-9H3 |
| InChIKey | KOJLPKOEACSCNM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|