About methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate
methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate (PubChem CID 170086720) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate.
Molecular Properties
| Compound Name | methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate |
| PubChem CID | 170086720 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate |
| SMILES | C=C/C(OC)=C(CSCC(=O)OC)\C(=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H17NO5S/c1-5-10(13(15)16)9(11(6-2)17-3)7-19-8-12(14)18-4/h5-6H,2,7-8H2,1,3-4H3/b10-5+,11-9+ |
| InChIKey | BUNKVXJZEVAUIB-WTIVLTGYSA-N |
| XLogP | 2.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate?
The IUPAC name of methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate (CID 170086720) is methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate.
What is the SMILES notation for methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate?
The canonical SMILES for methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate is C=C/C(OC)=C(CSCC(=O)OC)\C(=C/C)[N+](=O)[O-].
What is the InChIKey of methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate?
The InChIKey is BUNKVXJZEVAUIB-WTIVLTGYSA-N. The full InChI is InChI=1S/C12H17NO5S/c1-5-10(13(15)16)9(11(6-2)17-3)7-19-8-12(14)18-4/h5-6H,2,7-8H2,1,3-4H3/b10-5+,11-9+.
What are the key properties of methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate?
methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate has a molecular weight of 287.34 g/mol, XLogP of 2.16, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2Z)-3-methoxy-2-[(E)-1-nitroprop-1-enyl]penta-2,4-dienyl]sulfanylacetate is sourced from PubChem (CID 170086720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).