About 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine
4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine (PubChem CID 170087346) has the molecular formula C21H25ClN2
and a molecular weight of 340.90 g/mol. Its IUPAC name is 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine |
| PubChem CID | 170087346 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N[C@H]2CC2c2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2/c22-17-7-5-15(6-8-17)14-1-3-16(4-2-14)20-13-21(20)24-19-11-9-18(23)10-12-19/h1-8,18-21,24H,9-13,23H2/t18?,19?,20?,21-/m0/s1 |
| InChIKey | LQYQJOCXYVTVDS-FNNAPWSISA-N |
| XLogP | 4.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine?
The IUPAC name of 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine (CID 170087346) is 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine?
The canonical SMILES for 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine is NC1CCC(N[C@H]2CC2c2ccc(-c3ccc(Cl)cc3)cc2)CC1.
What is the InChIKey of 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine?
The InChIKey is LQYQJOCXYVTVDS-FNNAPWSISA-N. The full InChI is InChI=1S/C21H25ClN2/c22-17-7-5-15(6-8-17)14-1-3-16(4-2-14)20-13-21(20)24-19-11-9-18(23)10-12-19/h1-8,18-21,24H,9-13,23H2/t18?,19?,20?,21-/m0/s1.
What are the key properties of 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine?
4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine has a molecular weight of 340.90 g/mol, XLogP of 4.72, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 170087346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).