C21H25ClN2 — CID 170087346
4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine (PubChem CID 170087346) has the molecular formula C21H25ClN2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 170087346 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-N-[(1S)-2-[4-(4-chlorophenyl)phenyl]cyclopropyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N[C@H]2CC2c2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN2/c22-17-7-5-15(6-8-17)14-1-3-16(4-2-14)20-13-21(20)24-19-11-9-18(23)10-12-19/h1-8,18-21,24H,9-13,23H2/t18?,19?,20?,21-/m0/s1 |
| InChIKey | LQYQJOCXYVTVDS-FNNAPWSISA-N |
| XLogP | 4.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |