C32H37ClFN5O2 — CID 170087473
4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[6-(dimethylamino)hexoxy]-8-fluoroquinazolin-7-yl]naphthalen-2-ol (PubChem CID 170087473) has the molecular formula C32H37ClFN5O2 and a molecular weight of 578.13 g/mol. Its IUPAC name is 4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[6-(dimethylamino)hexoxy]-8-fluoroquinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[6-(dimethylamino)hexoxy]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 170087473 |
| Molecular Formula | C32H37ClFN5O2 |
| Molecular Weight | 578.13 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 4-[6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[6-(dimethylamino)hexoxy]-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
| SMILES | CN(C)CCCCCCOc1nc(N2CC3CCC(C2)N3)c2cc(Cl)c(-c3cc(O)cc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C32H37ClFN5O2/c1-38(2)13-7-3-4-8-14-41-32-36-30-26(31(37-32)39-18-21-11-12-22(19-39)35-21)17-27(33)28(29(30)34)25-16-23(40)15-20-9-5-6-10-24(20)25/h5-6,9-10,15-17,21-22,35,40H,3-4,7-8,11-14,18-19H2,1-2H3 |
| InChIKey | HMDNIJXWZOKGFB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.13 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|