C33H37BrN6O6 — CID 170087586
pent-4-enyl N-[3-acetyl-1-[2-[(1R,3S,5S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazol-6-yl]carbamate (PubChem CID 170087586) has the molecular formula C33H37BrN6O6 and a molecular weight of 693.60 g/mol. Its IUPAC name is pent-4-enyl N-[3-acetyl-1-[2-[(1R,3S,5S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazol-6-yl]carbamate.
| Compound Name | pent-4-enyl N-[3-acetyl-1-[2-[(1R,3S,5S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazol-6-yl]carbamate |
|---|---|
| PubChem CID | 170087586 |
| Molecular Formula | C33H37BrN6O6 |
| Molecular Weight | 693.60 g/mol |
| Exact Mass | 692.20 |
| IUPAC Name | pent-4-enyl N-[3-acetyl-1-[2-[(1R,3S,5S)-3-[(6-bromo-3-methyl-2-pyridinyl)carbamoyl]-5-(prop-2-enoxymethyl)-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazol-6-yl]carbamate |
| SMILES | C=CCCCOC(=O)Nc1ccc2c(C(C)=O)nn(CC(=O)N3[C@H](C(=O)Nc4nc(Br)ccc4C)C[C@@]4(COCC=C)C[C@@H]34)c2c1 |
| InChI | InChI=1S/C33H37BrN6O6/c1-5-7-8-14-46-32(44)35-22-10-11-23-24(15-22)39(38-29(23)21(4)41)18-28(42)40-25(16-33(17-26(33)40)19-45-13-6-2)31(43)37-30-20(3)9-12-27(34)36-30/h5-6,9-12,15,25-26H,1-2,7-8,13-14,16-19H2,3-4H3,(H,35,44)(H,36,37,43)/t25-,26+,33-/m0/s1 |
| InChIKey | PQJLASAARCUGKH-REYAJUCUSA-N |
| XLogP | 5.42 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|