C36H40F3N5 — CID 170088990
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(5,7-dimethyl-2,3,4,5-tetrahydroazepin-1-yl)butyl]-6,8-difluoro-7-(2-fluoronaphthalen-1-yl)quinazoline (PubChem CID 170088990) has the molecular formula C36H40F3N5 and a molecular weight of 599.75 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(5,7-dimethyl-2,3,4,5-tetrahydroazepin-1-yl)butyl]-6,8-difluoro-7-(2-fluoronaphthalen-1-yl)quinazoline.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(5,7-dimethyl-2,3,4,5-tetrahydroazepin-1-yl)butyl]-6,8-difluoro-7-(2-fluoronaphthalen-1-yl)quinazoline |
|---|---|
| PubChem CID | 170088990 |
| Molecular Formula | C36H40F3N5 |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-[4-(5,7-dimethyl-2,3,4,5-tetrahydroazepin-1-yl)butyl]-6,8-difluoro-7-(2-fluoronaphthalen-1-yl)quinazoline |
| SMILES | CC1=CC(C)CCCN1CCCCc1nc(N2CC3CCC(C2)N3)c2cc(F)c(-c3c(F)ccc4ccccc34)c(F)c2n1 |
| InChI | InChI=1S/C36H40F3N5/c1-22-8-7-17-43(23(2)18-22)16-6-5-11-31-41-35-28(36(42-31)44-20-25-13-14-26(21-44)40-25)19-30(38)33(34(35)39)32-27-10-4-3-9-24(27)12-15-29(32)37/h3-4,9-10,12,15,18-19,22,25-26,40H,5-8,11,13-14,16-17,20-21H2,1-2H3 |
| InChIKey | XSRPFLYZWDERGD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|