C21H30N4O7S — CID 170089438
[(E)-1-[(4R)-4-amino-4-[[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] ethyl carbonate (PubChem CID 170089438) has the molecular formula C21H30N4O7S and a molecular weight of 482.56 g/mol. Its IUPAC name is [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] ethyl carbonate.
| Compound Name | [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] ethyl carbonate |
|---|---|
| PubChem CID | 170089438 |
| Molecular Formula | C21H30N4O7S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | [(E)-1-[(4R)-4-amino-4-[[(1R)-1-(2-hydroxy-4-prop-2-enoxy-2H-pyran-6-yl)butyl]carbamoyl]-5H-1,3-thiazol-2-yl]ethylideneamino] ethyl carbonate |
| SMILES | C=CCOC1=CC(O)OC([C@@H](CCC)NC(=O)[C@]2(N)CSC(/C(C)=N/OC(=O)OCC)=N2)=C1 |
| InChI | InChI=1S/C21H30N4O7S/c1-5-8-15(16-10-14(30-9-6-2)11-17(26)31-16)23-19(27)21(22)12-33-18(24-21)13(4)25-32-20(28)29-7-3/h6,10-11,15,17,26H,2,5,7-9,12,22H2,1,3-4H3,(H,23,27)/b25-13+/t15-,17?,21+/m1/s1 |
| InChIKey | UVTZILWJOWOINW-ZQDNWYSMSA-N |
| XLogP | 1.94 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|