C19H35N3S — CID 170089543
3-methyl-N-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pent-1-en-2-yl]heptan-1-amine (PubChem CID 170089543) has the molecular formula C19H35N3S and a molecular weight of 337.58 g/mol. Its IUPAC name is 3-methyl-N-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pent-1-en-2-yl]heptan-1-amine.
| Compound Name | 3-methyl-N-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pent-1-en-2-yl]heptan-1-amine |
|---|---|
| PubChem CID | 170089543 |
| Molecular Formula | C19H35N3S |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 3-methyl-N-[5-(2-methylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pent-1-en-2-yl]heptan-1-amine |
| SMILES | C=C(CCCC1SCC2NC(=C)NC21)NCCC(C)CCCC |
| InChI | InChI=1S/C19H35N3S/c1-5-6-8-14(2)11-12-20-15(3)9-7-10-18-19-17(13-23-18)21-16(4)22-19/h14,17-22H,3-13H2,1-2H3 |
| InChIKey | MNPABZUHYOIPSN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |