C22H27N5O5 — CID 170090196
ethyl 5-methyl-2-[(Z)-[6-oxo-2-[2-oxo-2-(2-propoxyethylamino)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-7-ylidene]methyl]-1H-pyrrole-3-carboxylate (PubChem CID 170090196) has the molecular formula C22H27N5O5 and a molecular weight of 441.49 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(Z)-[6-oxo-2-[2-oxo-2-(2-propoxyethylamino)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-7-ylidene]methyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(Z)-[6-oxo-2-[2-oxo-2-(2-propoxyethylamino)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-7-ylidene]methyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 170090196 |
| Molecular Formula | C22H27N5O5 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethyl 5-methyl-2-[(Z)-[6-oxo-2-[2-oxo-2-(2-propoxyethylamino)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-7-ylidene]methyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCCOCCNC(=O)Cc1ncc2c(n1)/C(=C/c1[nH]c(C)cc1C(=O)OCC)C(=O)N2 |
| InChI | InChI=1S/C22H27N5O5/c1-4-7-31-8-6-23-19(28)11-18-24-12-17-20(27-18)15(21(29)26-17)10-16-14(9-13(3)25-16)22(30)32-5-2/h9-10,12,25H,4-8,11H2,1-3H3,(H,23,28)(H,26,29)/b15-10- |
| InChIKey | FSIJPFGMWXGHDC-GDNBJRDFSA-N |
| XLogP | 1.87 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|