C15H28O2 — CID 170090403
1-(1-ethenyl-2,2-dimethylcyclopentyl)oxy-2,2-dimethylbutan-1-ol (PubChem CID 170090403) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(1-ethenyl-2,2-dimethylcyclopentyl)oxy-2,2-dimethylbutan-1-ol.
| Compound Name | 1-(1-ethenyl-2,2-dimethylcyclopentyl)oxy-2,2-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 170090403 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-(1-ethenyl-2,2-dimethylcyclopentyl)oxy-2,2-dimethylbutan-1-ol |
| SMILES | C=CC1(OC(O)C(C)(C)CC)CCCC1(C)C |
| InChI | InChI=1S/C15H28O2/c1-7-13(3,4)12(16)17-15(8-2)11-9-10-14(15,5)6/h8,12,16H,2,7,9-11H2,1,3-6H3 |
| InChIKey | UJCBXHYHKSOUCT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|