C34H40F2N4 — CID 170090779
6-[(Z)-2-(8-ethyl-7-fluoronaphthalen-1-yl)-1-fluoroethenyl]-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-N,N-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]pyrimidin-4-amine (PubChem CID 170090779) has the molecular formula C34H40F2N4 and a molecular weight of 542.72 g/mol. Its IUPAC name is 6-[(Z)-2-(8-ethyl-7-fluoronaphthalen-1-yl)-1-fluoroethenyl]-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-N,N-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]pyrimidin-4-amine.
| Compound Name | 6-[(Z)-2-(8-ethyl-7-fluoronaphthalen-1-yl)-1-fluoroethenyl]-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-N,N-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170090779 |
| Molecular Formula | C34H40F2N4 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 6-[(Z)-2-(8-ethyl-7-fluoronaphthalen-1-yl)-1-fluoroethenyl]-2-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethyl]-N,N-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]pyrimidin-4-amine |
| SMILES | C=C/C(C)=C/c1c(/C(F)=C/c2cccc3ccc(F)c(CC)c23)nc(CCC23CCCN2CCC3)nc1N(C)C |
| InChI | InChI=1S/C34H40F2N4/c1-6-23(3)21-27-32(29(36)22-25-12-8-11-24-13-14-28(35)26(7-2)31(24)25)37-30(38-33(27)39(4)5)15-18-34-16-9-19-40(34)20-10-17-34/h6,8,11-14,21-22H,1,7,9-10,15-20H2,2-5H3/b23-21+,29-22- |
| InChIKey | QJBAVEPWXQAFNJ-HUOHVSLJSA-N |
| XLogP | 8.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|