C28H39N3OS — CID 170090943
3-[3-tert-butylsulfanyl-5-methoxy-1-[(4-methylphenyl)methyl]indol-2-yl]-N,N',2,2-tetramethylpropanimidamide (PubChem CID 170090943) has the molecular formula C28H39N3OS and a molecular weight of 465.71 g/mol. Its IUPAC name is 3-[3-tert-butylsulfanyl-5-methoxy-1-[(4-methylphenyl)methyl]indol-2-yl]-N,N',2,2-tetramethylpropanimidamide.
| Compound Name | 3-[3-tert-butylsulfanyl-5-methoxy-1-[(4-methylphenyl)methyl]indol-2-yl]-N,N',2,2-tetramethylpropanimidamide |
|---|---|
| PubChem CID | 170090943 |
| Molecular Formula | C28H39N3OS |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 3-[3-tert-butylsulfanyl-5-methoxy-1-[(4-methylphenyl)methyl]indol-2-yl]-N,N',2,2-tetramethylpropanimidamide |
| SMILES | C/N=C(\NC)C(C)(C)Cc1c(SC(C)(C)C)c2cc(OC)ccc2n1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C28H39N3OS/c1-19-10-12-20(13-11-19)18-31-23-15-14-21(32-9)16-22(23)25(33-27(2,3)4)24(31)17-28(5,6)26(29-7)30-8/h10-16H,17-18H2,1-9H3,(H,29,30) |
| InChIKey | VLFOVPDTCKXLJD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|