C33H35ClFN5O3 — CID 170091069
4-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-ylmethoxy)-6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoroquinazolin-7-yl]naphthalen-2-ol (PubChem CID 170091069) has the molecular formula C33H35ClFN5O3 and a molecular weight of 604.13 g/mol. Its IUPAC name is 4-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-ylmethoxy)-6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoroquinazolin-7-yl]naphthalen-2-ol.
| Compound Name | 4-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-ylmethoxy)-6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 170091069 |
| Molecular Formula | C33H35ClFN5O3 |
| Molecular Weight | 604.13 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 4-[2-(1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-7-ylmethoxy)-6-chloro-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoroquinazolin-7-yl]naphthalen-2-ol |
| SMILES | Oc1cc(-c2c(Cl)cc3c(N4CC5CCC(C4)N5)nc(OCC4CCC5COCCN5C4)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C33H35ClFN5O3/c34-28-13-27-31(30(35)29(28)26-12-24(41)11-20-3-1-2-4-25(20)26)37-33(38-32(27)40-15-21-6-7-22(16-40)36-21)43-17-19-5-8-23-18-42-10-9-39(23)14-19/h1-4,11-13,19,21-23,36,41H,5-10,14-18H2 |
| InChIKey | FJJKFQPXNVUQBT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.13 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |