C20H15N3O2 — CID 170092111
3-methyl-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 170092111) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-methyl-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 3-methyl-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170092111 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-methyl-5,7-diphenylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nn2c(-c3ccccc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C20H15N3O2/c1-13-18(20(24)25)22-23-17(15-10-6-3-7-11-15)12-16(21-19(13)23)14-8-4-2-5-9-14/h2-12H,1H3,(H,24,25) |
| InChIKey | KOCRFKXBQKQLAU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |