C14H20BrFN6S2 — CID 170092607
N-(2-aminoethyl)-N'-[2-bromo-5-fluoro-4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]butane-1,4-diamine (PubChem CID 170092607) has the molecular formula C14H20BrFN6S2 and a molecular weight of 435.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[2-bromo-5-fluoro-4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]butane-1,4-diamine.
| Compound Name | N-(2-aminoethyl)-N'-[2-bromo-5-fluoro-4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 170092607 |
| Molecular Formula | C14H20BrFN6S2 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N-(2-aminoethyl)-N'-[2-bromo-5-fluoro-4-(1,2,4-thiadiazol-5-ylamino)sulfanylphenyl]butane-1,4-diamine |
| SMILES | NCCNCCCCNc1cc(F)c(SNc2ncns2)cc1Br |
| InChI | InChI=1S/C14H20BrFN6S2/c15-10-7-13(23-22-14-20-9-21-24-14)11(16)8-12(10)19-5-2-1-4-18-6-3-17/h7-9,18-19H,1-6,17H2,(H,20,21,22) |
| InChIKey | FAYFJHDXLAIQMF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|